![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 3401 School Cancellation Delay and Early Dismissal.pdf | 2022-02-23 17:28 | 113K | |
| 3402 Drills Plans and Reports-1.pdf | 2024-10-04 16:21 | 117K | |
| 3402 Drills Plans and Reports-2.pdf | 2024-10-04 16:23 | 117K | |
| 3402 Drills Plans and Reports.pdf | 2022-02-23 17:28 | 125K | |
| 3403 Reporting Accidents.pdf | 2022-02-23 17:28 | 113K | |
| 3404 Communicable Diseases.pdf | 2022-02-23 17:28 | 127K | |
| 3405 Bloodborne Pathogens-1.pdf | 2023-09-20 18:23 | 107K | |
| 3405 Bloodborne Pathogens.pdf | 2022-02-23 17:28 | 121K | |
| 3406 Integrated Pest Management.pdf | 2022-02-23 17:28 | 130K | |
| 3407 Asbestos Management-1.pdf | 2023-09-20 18:23 | 111K | |
| 3407 Asbestos Management-2.pdf | 2024-10-02 19:16 | 111K | |
| 3407 Asbestos Management.pdf | 2022-02-23 17:28 | 126K | |
| 3408 Firearms and Weapons-1.pdf | 2023-09-20 18:23 | 122K | |
| 3408 Firearms and Weapons-2.pdf | 2024-10-04 16:21 | 126K | |
| 3408 Firearms and Weapons.pdf | 2022-02-23 17:28 | 140K | |
| 3409 Intentionally Left Blank.pdf | 2022-02-23 17:33 | 8.2K | |
| 3410 Opioid Antagonist.pdf | 2024-10-04 16:19 | 113K | |
|
|---|